Products 33682-88-1
CAS 33682-88-1 is the registry number for 1-(4-Bromophenyl)-2-methyl-2-nitropropan-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-bromophenyl)-2-methyl-2-nitropropan-1-ol (CAS 33682-88-1) is a chemical compound with the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. IUPAC name: 1-(4-bromophenyl)-2-methyl-2-nitropropan-1-ol. InChIKey: QVLHYPHMTPDZEP-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO3 |
|---|---|
| Molecular weight | 274.11 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-methyl-2-nitropropan-1-ol |
| InChIKey | QVLHYPHMTPDZEP-UHFFFAOYSA-N |
| SMILES | CC(C)(C(C1=CC=C(C=C1)Br)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)