CAS 4920-77-8 appears in our catalog under these names: 3-Methyl-2-nitrophenol, 96%, 3-Methyl-2-nitrophenol, >95% (HPLC), 3-Methyl-2-nitrophenol, 2–Nitro–m–cresol, 2-Nitro-m-cresol, >98.0%(GC)(T). Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, TCI. Available pack sizes: 500g, 100g, 25g, 1g, 100mg, 5g, 50g, 250g.
3-methyl-2-nitrophenol (CAS 4920-77-8) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 3-methyl-2-nitrophenol. InChIKey: QIORDSKCCHRSSD-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 3-methyl-2-nitrophenol |
| InChIKey | QIORDSKCCHRSSD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)