CAS 33837-83-1 is the registry number for 3–(1,1–Dimethyl)–4–hydroxy–5–methoxy–benzaldehyde. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
3-tert-butyl-4-hydroxy-5-methoxybenzaldehyde (CAS 33837-83-1) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 3-tert-butyl-4-hydroxy-5-methoxybenzaldehyde. InChIKey: KIRFITNPTAAANI-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 3-tert-butyl-4-hydroxy-5-methoxybenzaldehyde |
| InChIKey | KIRFITNPTAAANI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=CC(=C1)C=O)OC)O |
Computed by PubChem (NCBI)