CAS 3384-30-3 is the registry number for 2-(2-Chlorophenoxymethyl)-1H-1,3-benzodiazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[(2-chlorophenoxy)methyl]-1H-benzimidazole (CAS 3384-30-3) is a chemical compound with the molecular formula C14H11ClN2O and a molecular weight of 258.70 g/mol. IUPAC name: 2-[(2-chlorophenoxy)methyl]-1H-benzimidazole. InChIKey: UIPOKFUXNJLYAO-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 2-[(2-chlorophenoxy)methyl]-1H-benzimidazole |
| InChIKey | UIPOKFUXNJLYAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)COC3=CC=CC=C3Cl |
Computed by PubChem (NCBI)