Products 33841-03-1

CAS 33841-03-1 is the registry number for Nadolol EP Impurity G. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(tert-butylamino)-3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propan-2-ol (CAS 33841-03-1) is a chemical compound with the molecular formula C17H27NO2 and a molecular weight of 277.4 g/mol. IUPAC name: 1-(tert-butylamino)-3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propan-2-ol. InChIKey: ZTYWAQSTDRZAAS-UHFFFAOYSA-N.

Identity
Molecular formulaC17H27NO2
Molecular weight277.4 g/mol
IUPAC name1-(tert-butylamino)-3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propan-2-ol
InChIKeyZTYWAQSTDRZAAS-UHFFFAOYSA-N
SMILESCC(C)(C)NCC(COC1=CC=CC2=C1CCCC2)O

Computed by PubChem (NCBI)