Products 1020720-02-8
CAS 1020720-02-8 appears in our catalog under these names: D,L-Venlafaxine-d6 (100 μg/mL in Methanol), D,L-Venlafaxine-d6, >95% (HPLC), Venlafaxine–d6, Venlafaxine-d6, 98.55%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 5x1ml, 50mg, 5mg, 5 mg.
3,3,4,4,5,5-hexadeuterio-1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol (CAS 1020720-02-8) is a chemical compound with the molecular formula C17H27NO2 and a molecular weight of 283.44 g/mol. IUPAC name: 3,3,4,4,5,5-hexadeuterio-1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol. InChIKey: PNVNVHUZROJLTJ-KETLRHEYSA-N.
| Molecular formula | C17H27NO2 |
|---|---|
| Molecular weight | 283.44 g/mol |
| IUPAC name | 3,3,4,4,5,5-hexadeuterio-1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol |
| InChIKey | PNVNVHUZROJLTJ-KETLRHEYSA-N |
| SMILES | [2H]C1(CC(CC(C1([2H])[2H])([2H])[2H])(C(CN(C)C)C2=CC=C(C=C2)OC)O)[2H] |
Computed by PubChem (NCBI)