CAS 940297-06-3 appears in our catalog under these names: Venlafaxine-d6, 1-(2-(Di(methyl-d3)amino)-1-(4-methoxyphenyl)ethyl)-cyclohexanol, Venlafaxine-d6-1. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 5 mg, 1 mg, 10 mg.
1-[2-[bis(trideuteriomethyl)amino]-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol (CAS 940297-06-3) is a chemical compound with the molecular formula C17H27NO2 and a molecular weight of 283.44 g/mol. IUPAC name: 1-[2-[bis(trideuteriomethyl)amino]-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol. InChIKey: PNVNVHUZROJLTJ-WFGJKAKNSA-N.
| Molecular formula | C17H27NO2 |
|---|---|
| Molecular weight | 283.44 g/mol |
| IUPAC name | 1-[2-[bis(trideuteriomethyl)amino]-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol |
| InChIKey | PNVNVHUZROJLTJ-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(CC(C1=CC=C(C=C1)OC)C2(CCCCC2)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)