CAS 33880-83-0 appears in our catalog under these names: b-Elemene, Elemene - mixture of isomers. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg.
1-ethenyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane (CAS 33880-83-0) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: 1-ethenyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane. InChIKey: OPFTUNCRGUEPRZ-UHFFFAOYSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | 1-ethenyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane |
| InChIKey | OPFTUNCRGUEPRZ-UHFFFAOYSA-N |
| SMILES | CC(=C)C1CCC(C(C1)C(=C)C)(C)C=C |
Computed by PubChem (NCBI)