Products 338955-07-0
CAS 338955-07-0 is the registry number for 1-((4-Methoxyphenyl)methyl)-2,5,6-trimethyl-4-nitro-1H-1,3-benzodiazole. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg.
1-[(4-methoxyphenyl)methyl]-2,5,6-trimethyl-4-nitrobenzimidazole (CAS 338955-07-0) is a chemical compound with the molecular formula C18H19N3O3 and a molecular weight of 325.4 g/mol. IUPAC name: 1-[(4-methoxyphenyl)methyl]-2,5,6-trimethyl-4-nitrobenzimidazole. InChIKey: BUUOSKGDHHHKLK-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 1-[(4-methoxyphenyl)methyl]-2,5,6-trimethyl-4-nitrobenzimidazole |
| InChIKey | BUUOSKGDHHHKLK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1C)[N+](=O)[O-])N=C(N2CC3=CC=C(C=C3)OC)C |
Computed by PubChem (NCBI)