CAS 339370-16-0 is the registry number for 5-tert-Butyl-2,3-dimethylbenzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-tert-butyl-2,3-dimethylbenzenesulfonyl chloride (CAS 339370-16-0) is a chemical compound with the molecular formula C12H17ClO2S and a molecular weight of 260.78 g/mol. IUPAC name: 5-tert-butyl-2,3-dimethylbenzenesulfonyl chloride. InChIKey: VYWPKUNQVPGULH-UHFFFAOYSA-N.
| Molecular formula | C12H17ClO2S |
|---|---|
| Molecular weight | 260.78 g/mol |
| IUPAC name | 5-tert-butyl-2,3-dimethylbenzenesulfonyl chloride |
| InChIKey | VYWPKUNQVPGULH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)S(=O)(=O)Cl)C(C)(C)C |
Computed by PubChem (NCBI)