Products 70823-04-0

CAS 70823-04-0 appears in our catalog under these names: 4-(tert-Butyl)-2,6-dimethylbenzene-1-sulfonyl chloride, 95+%, 2,6-Dimethyl-4-tert-butylbenzenesulfonyl chloride, 95+%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

4-tert-butyl-2,6-dimethylbenzenesulfonyl chloride (CAS 70823-04-0) is a chemical compound with the molecular formula C12H17ClO2S and a molecular weight of 260.78 g/mol. IUPAC name: 4-tert-butyl-2,6-dimethylbenzenesulfonyl chloride. InChIKey: HZWYWYSLHBTTRW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17ClO2S
Molecular weight260.78 g/mol
IUPAC name4-tert-butyl-2,6-dimethylbenzenesulfonyl chloride
InChIKeyHZWYWYSLHBTTRW-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1S(=O)(=O)Cl)C)C(C)(C)C

Computed by PubChem (NCBI)