CAS 70823-04-0 appears in our catalog under these names: 4-(tert-Butyl)-2,6-dimethylbenzene-1-sulfonyl chloride, 95+%, 2,6-Dimethyl-4-tert-butylbenzenesulfonyl chloride, 95+%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 500mg, 1g.
4-tert-butyl-2,6-dimethylbenzenesulfonyl chloride (CAS 70823-04-0) is a chemical compound with the molecular formula C12H17ClO2S and a molecular weight of 260.78 g/mol. IUPAC name: 4-tert-butyl-2,6-dimethylbenzenesulfonyl chloride. InChIKey: HZWYWYSLHBTTRW-UHFFFAOYSA-N.
| Molecular formula | C12H17ClO2S |
|---|---|
| Molecular weight | 260.78 g/mol |
| IUPAC name | 4-tert-butyl-2,6-dimethylbenzenesulfonyl chloride |
| InChIKey | HZWYWYSLHBTTRW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1S(=O)(=O)Cl)C)C(C)(C)C |
Computed by PubChem (NCBI)