Products 61942-72-1

CAS 61942-72-1 is the registry number for 2,5-Bis(propan-2-yl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,5-di(propan-2-yl)benzenesulfonyl chloride (CAS 61942-72-1) is a chemical compound with the molecular formula C12H17ClO2S and a molecular weight of 260.78 g/mol. IUPAC name: 2,5-di(propan-2-yl)benzenesulfonyl chloride. InChIKey: OUZQFXRSNCKYFE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17ClO2S
Molecular weight260.78 g/mol
IUPAC name2,5-di(propan-2-yl)benzenesulfonyl chloride
InChIKeyOUZQFXRSNCKYFE-UHFFFAOYSA-N
SMILESCC(C)C1=CC(=C(C=C1)C(C)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)