CAS 61942-72-1 is the registry number for 2,5-Bis(propan-2-yl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,5-di(propan-2-yl)benzenesulfonyl chloride (CAS 61942-72-1) is a chemical compound with the molecular formula C12H17ClO2S and a molecular weight of 260.78 g/mol. IUPAC name: 2,5-di(propan-2-yl)benzenesulfonyl chloride. InChIKey: OUZQFXRSNCKYFE-UHFFFAOYSA-N.
| Molecular formula | C12H17ClO2S |
|---|---|
| Molecular weight | 260.78 g/mol |
| IUPAC name | 2,5-di(propan-2-yl)benzenesulfonyl chloride |
| InChIKey | OUZQFXRSNCKYFE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1)C(C)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)