CAS 339370-19-3 is the registry number for Ethyl 4-(tert-Butyl)benzenesulfonate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 500mg, 50mg.
Ethyl 4-tert-butylbenzenesulfonate (CAS 339370-19-3) is a chemical compound with the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. IUPAC name: ethyl 4-tert-butylbenzenesulfonate. InChIKey: PBFSAXBNEJICKS-UHFFFAOYSA-N.
| Molecular formula | C12H18O3S |
|---|---|
| Molecular weight | 242.34 g/mol |
| IUPAC name | ethyl 4-tert-butylbenzenesulfonate |
| InChIKey | PBFSAXBNEJICKS-UHFFFAOYSA-N |
| SMILES | CCOS(=O)(=O)C1=CC=C(C=C1)C(C)(C)C |
Computed by PubChem (NCBI)