Products 3813-69-2
CAS 3813-69-2 is the registry number for Pentan-2-yl 4-methylbenzenesulfonate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
Pentan-2-yl 4-methylbenzenesulfonate (CAS 3813-69-2) is a chemical compound with the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. IUPAC name: pentan-2-yl 4-methylbenzenesulfonate. InChIKey: HQSHAZLGVDYADJ-UHFFFAOYSA-N.
| Molecular formula | C12H18O3S |
|---|---|
| Molecular weight | 242.34 g/mol |
| IUPAC name | pentan-2-yl 4-methylbenzenesulfonate |
| InChIKey | HQSHAZLGVDYADJ-UHFFFAOYSA-N |
| SMILES | CCCC(C)OS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)
Synonyms:
2-Pentyl tosylate, 1-Methylbutyl tosylate, 2-Pentanol, 4-methylbenzenesulfonate, 2-Pentanol, 2-(4-methylbenzenesulfonate), 2-Pentanol, p-toluenesulfonate, p-Toluenesulfonic acid, 2-pentyl ester, 4-11-00-00251 (Beilstein Handbook Reference), 2-Pentyl p-toluenesulfonate, Pentan-2-yl 4-methylbenzene-1-sulfonate, pentan-2-yl 4-methylbenzenesulfonate