CAS 38261-81-3 appears in our catalog under these names: P-Toluenesulfonic acid (s)-2-methylbutyl ester, 95%, (S)-2-Methylbutyl 4-methylbenzenesulfonate, 98%, |p|–Toluenesulfonic acid (|S|)–2–methylbutyl ester, (S)-2-Methylbutyl p-Toluenesulfonate, >95.0%(GC), (S)-2-Methylbutyl 4-methylbenzenesulfonate, 95%(GC-MS),RG, 95%(GC-MS),RG. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 1g, 5g.
[(2S)-2-methylbutyl] 4-methylbenzenesulfonate (CAS 38261-81-3) is a chemical compound with the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. IUPAC name: [(2S)-2-methylbutyl] 4-methylbenzenesulfonate. InChIKey: HPEVJTNZYIMANV-JTQLQIEISA-N.
| Molecular formula | C12H18O3S |
|---|---|
| Molecular weight | 242.34 g/mol |
| IUPAC name | [(2S)-2-methylbutyl] 4-methylbenzenesulfonate |
| InChIKey | HPEVJTNZYIMANV-JTQLQIEISA-N |
| SMILES | CC[C@H](C)COS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)