CAS 3396-73-4 appears in our catalog under these names: (2R,4S)-2,4,5-Trihydroxypentanal, 95%, 3-Deoxy-D-ribose. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 250mg, 1g, 0,5g, 2g.
(2R,4S)-2,4,5-trihydroxypentanal (CAS 3396-73-4) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (2R,4S)-2,4,5-trihydroxypentanal. InChIKey: GKHJPQPGKIAEJO-UHNVWZDZSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (2R,4S)-2,4,5-trihydroxypentanal |
| InChIKey | GKHJPQPGKIAEJO-UHNVWZDZSA-N |
| SMILES | C([C@@H](CO)O)[C@H](C=O)O |
Computed by PubChem (NCBI)