CAS 33984-30-4 is the registry number for (4-Chloro-phenylamino)-phenyl-acetic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-(4-chloroanilino)-2-phenylacetic acid (CAS 33984-30-4) is a chemical compound with the molecular formula C14H12ClNO2 and a molecular weight of 261.70 g/mol. IUPAC name: 2-(4-chloroanilino)-2-phenylacetic acid. InChIKey: DPUWGZGZBBLNHZ-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO2 |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | 2-(4-chloroanilino)-2-phenylacetic acid |
| InChIKey | DPUWGZGZBBLNHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)