CAS 67531-86-6 appears in our catalog under these names: 6-Fluorosalicylic acid, 98+%, 6-Fluorosalicylic acid, 96%, 2–Fluoro–6–hydroxybenzoic acid, 2-Fluoro-6-hydroxybenzoic acid, 6-Fluorosalicylic Acid, >98.0%(GC)(T). Offered by: Thermo Scientific (Acros), Fluorochem, GLPBio, Biosynth, TCI. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 2g, 1000g.
2-fluoro-6-hydroxybenzoic acid (CAS 67531-86-6) is a chemical compound with the molecular formula C7H5FO3 and a molecular weight of 156.11 g/mol. IUPAC name: 2-fluoro-6-hydroxybenzoic acid. InChIKey: BCEKGWWLVKXZKK-UHFFFAOYSA-N.
| Molecular formula | C7H5FO3 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 2-fluoro-6-hydroxybenzoic acid |
| InChIKey | BCEKGWWLVKXZKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)O)O |
Computed by PubChem (NCBI)