CAS 341-39-9 appears in our catalog under these names: 2,2,2-Trifluoro-1-(o-tolyl)ethan-1-one 95%, 2'-METHYL-2,2,2-TRIFLUOROACETOPHENONE, 95%, 95%, 2'-Methyl-2,2,2-trifluoroacetophenone, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2,2,2-trifluoro-1-(2-methylphenyl)ethanone (CAS 341-39-9) is a chemical compound with the molecular formula C9H7F3O and a molecular weight of 188.15 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2-methylphenyl)ethanone. InChIKey: JHQDBQYFKARISA-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O |
|---|---|
| Molecular weight | 188.15 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2-methylphenyl)ethanone |
| InChIKey | JHQDBQYFKARISA-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)C(F)(F)F |
Computed by PubChem (NCBI)