CAS 3414-62-8 is the registry number for Inosine oxime. Offered by: MedChemExpress. Available pack sizes: 1 mg, 100 mg, 50 mg, 10 mg, 25 mg, 5 mg.
(2R,3R,4S,5R)-2-[6-(hydroxyamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (CAS 3414-62-8) is a chemical compound with the molecular formula C10H13N5O5 and a molecular weight of 283.24 g/mol. IUPAC name: (2R,3R,4S,5R)-2-[6-(hydroxyamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: QROZCFCNYCVEDO-KQYNXXCUSA-N.
| Molecular formula | C10H13N5O5 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-[6-(hydroxyamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | QROZCFCNYCVEDO-KQYNXXCUSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)NO |
Computed by PubChem (NCBI)