Products 341556-92-1
CAS 341556-92-1 is the registry number for 3-(4-(3-Formylphenyl)phenyl)benzaldehyde. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-[4-(3-formylphenyl)phenyl]benzaldehyde (CAS 341556-92-1) is a chemical compound with the molecular formula C20H14O2 and a molecular weight of 286.3 g/mol. IUPAC name: 3-[4-(3-formylphenyl)phenyl]benzaldehyde. InChIKey: GILFUNUROHDJOP-UHFFFAOYSA-N.
| Molecular formula | C20H14O2 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 3-[4-(3-formylphenyl)phenyl]benzaldehyde |
| InChIKey | GILFUNUROHDJOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=C(C=C2)C3=CC=CC(=C3)C=O)C=O |
Computed by PubChem (NCBI)