CAS 34165-08-7 appears in our catalog under these names: 5-Methyl-3-nitroimidazo[1,2-a]pyridine, 95%, 5–Methyl–3–nitroimidazo(1,2–a)pyridine, 5-Methyl-3-nitroimidazo[1,2-a]pyridine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg.
5-methyl-3-nitroimidazo[1,2-a]pyridine (CAS 34165-08-7) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 5-methyl-3-nitroimidazo[1,2-a]pyridine. InChIKey: OGZKKWYLIWRTHQ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-methyl-3-nitroimidazo[1,2-a]pyridine |
| InChIKey | OGZKKWYLIWRTHQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC2=NC=C(N12)[N+](=O)[O-] |
Computed by PubChem (NCBI)