CAS 34169-69-2 is the registry number for Pterosin Z. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 5mg, 50mg, Get quote.
6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-3H-inden-1-one (CAS 34169-69-2) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: 6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-3H-inden-1-one. InChIKey: YKQBHPHKXJKKAB-UHFFFAOYSA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | 6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-3H-inden-1-one |
| InChIKey | YKQBHPHKXJKKAB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1CCO)C)C(=O)C(C2)(C)C |
Computed by PubChem (NCBI)