Products 34224-31-2
CAS 34224-31-2 appears in our catalog under these names: 4-(tert-Butoxymethyl)benzoic acid, 95%, 4–(Tert–butoxymethyl)benzoic acid, 4-(tert-Butoxymethyl)benzoic acid, 95%+, 95%+, 4-(Tert-butoxymethyl)benzoic acid, 95%+. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
4-[(2-methylpropan-2-yl)oxymethyl]benzoic acid (CAS 34224-31-2) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxymethyl]benzoic acid. InChIKey: HXNWRKOKHLXUQN-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxymethyl]benzoic acid |
| InChIKey | HXNWRKOKHLXUQN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OCC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)