CAS 34235-82-0 appears in our catalog under these names: Nepsilon-carbobenzoxy-nalpha-tosyl-l-lysine, 95%, Nε–Carbobenzoxy–Nα–tosyl–L–lysine, Tos-Lys(Cbz)-OH 98%, NEPSILON-CARBOBENZOXY-NALPHA-TOSYL-L-LYSINE, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg.
(2S)-2-[(4-methylphenyl)sulfonylamino]-6-(phenylmethoxycarbonylamino)hexanoic acid (CAS 34235-82-0) is a chemical compound with the molecular formula C21H26N2O6S and a molecular weight of 434.5 g/mol. IUPAC name: (2S)-2-[(4-methylphenyl)sulfonylamino]-6-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: XSWGRGGVKUEBSE-IBGZPJMESA-N.
| Molecular formula | C21H26N2O6S |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | (2S)-2-[(4-methylphenyl)sulfonylamino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
| InChIKey | XSWGRGGVKUEBSE-IBGZPJMESA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CCCCNC(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)