CAS 70674-90-7 appears in our catalog under these names: Catharanthine Sulfate, Catharanthine sulfate/ 99.81% (existing batch purity), Catharanthine xsulfate, 98+%, 98+%. Offered by: GLPBio, TargetMol, Chemat. Available pack sizes: 20mg, 50mg, 100mg, 200mg, 250mg, 1g.
Methyl (1R,15R,18R)-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8,16-pentaene-1-carboxylate;sulfuric acid (CAS 70674-90-7) is a chemical compound with the molecular formula C21H26N2O6S and a molecular weight of 434.5 g/mol. IUPAC name: methyl (1R,15R,18R)-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8,16-pentaene-1-carboxylate;sulfuric acid. InChIKey: ULBHCCBAHJWZET-GYMDHWDQSA-N.
| Molecular formula | C21H26N2O6S |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | methyl (1R,15R,18R)-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8,16-pentaene-1-carboxylate;sulfuric acid |
| InChIKey | ULBHCCBAHJWZET-GYMDHWDQSA-N |
| SMILES | CCC1=C[C@H]2C[C@]3([C@@H]1N(C2)CCC4=C3NC5=CC=CC=C45)C(=O)OC.OS(=O)(=O)O |
Computed by PubChem (NCBI)