CAS 497060-58-9 is the registry number for methyl 2-(4,5-dimethoxy-2-((4-phenylpiperazinyl)sulfonyl)phenyl)acetate. Offered by: Biosynth. Available pack sizes: 250mg.
Methyl 2-[4,5-dimethoxy-2-(4-phenylpiperazin-1-yl)sulfonylphenyl]acetate (CAS 497060-58-9) is a chemical compound with the molecular formula C21H26N2O6S and a molecular weight of 434.5 g/mol. IUPAC name: methyl 2-[4,5-dimethoxy-2-(4-phenylpiperazin-1-yl)sulfonylphenyl]acetate. InChIKey: GMCDNVSDZHKEPD-UHFFFAOYSA-N.
| Molecular formula | C21H26N2O6S |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | methyl 2-[4,5-dimethoxy-2-(4-phenylpiperazin-1-yl)sulfonylphenyl]acetate |
| InChIKey | GMCDNVSDZHKEPD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CC(=O)OC)S(=O)(=O)N2CCN(CC2)C3=CC=CC=C3)OC |
Computed by PubChem (NCBI)