Products 342373-21-1
CAS 342373-21-1 is the registry number for 2-(4-(Naphthalene-2-sulfonamido)phenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-[4-(naphthalen-2-ylsulfonylamino)phenyl]acetic acid (CAS 342373-21-1) is a chemical compound with the molecular formula C18H15NO4S and a molecular weight of 341.4 g/mol. IUPAC name: 2-[4-(naphthalen-2-ylsulfonylamino)phenyl]acetic acid. InChIKey: DMWBQJUULJVOPA-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 2-[4-(naphthalen-2-ylsulfonylamino)phenyl]acetic acid |
| InChIKey | DMWBQJUULJVOPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)NC3=CC=C(C=C3)CC(=O)O |
Computed by PubChem (NCBI)