Products 342425-54-1
CAS 342425-54-1 is the registry number for methyl 2,7-dimethyl-1H-indole-3-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2,7-dimethyl-1H-indole-3-carboxylate (CAS 342425-54-1) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: methyl 2,7-dimethyl-1H-indole-3-carboxylate. InChIKey: LNXGKYCMQUKSCK-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | methyl 2,7-dimethyl-1H-indole-3-carboxylate |
| InChIKey | LNXGKYCMQUKSCK-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C(N2)C)C(=O)OC |
Computed by PubChem (NCBI)