CAS 342592-68-1 is the registry number for 4-[(2,4-Dichlorobenzyl)oxy]-3-methoxybenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[(2,4-dichlorophenyl)methoxy]-3-methoxybenzaldehyde (CAS 342592-68-1) is a chemical compound with the molecular formula C15H12Cl2O3 and a molecular weight of 311.2 g/mol. IUPAC name: 4-[(2,4-dichlorophenyl)methoxy]-3-methoxybenzaldehyde. InChIKey: INKHIZKVRPGGLJ-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2O3 |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | 4-[(2,4-dichlorophenyl)methoxy]-3-methoxybenzaldehyde |
| InChIKey | INKHIZKVRPGGLJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OCC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)