CAS 536974-83-1 appears in our catalog under these names: Methyl 4-(benzyloxy)-3,5-dichlorobenzoate, 95%, Methyl 4-(benzyloxy)-3,5-dichlorobenzoate, 98%, Methyl 4-(benzyloxy)-3,5-dichlorobenzoate. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 3,5-dichloro-4-phenylmethoxybenzoate (CAS 536974-83-1) is a chemical compound with the molecular formula C15H12Cl2O3 and a molecular weight of 311.2 g/mol. IUPAC name: methyl 3,5-dichloro-4-phenylmethoxybenzoate. InChIKey: HHJLUJGYZFXISM-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2O3 |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | methyl 3,5-dichloro-4-phenylmethoxybenzoate |
| InChIKey | HHJLUJGYZFXISM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Cl)OCC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)