Products 381205-83-0

CAS 381205-83-0 appears in our catalog under these names: 4-[(2-Chlorobenzyl)oxy]-3-methoxybenzoyl chloride, 95%, 4-((2-Chlorobenzyl)oxy)-3-methoxybenzoyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

4-[(2-chlorophenyl)methoxy]-3-methoxybenzoyl chloride (CAS 381205-83-0) is a chemical compound with the molecular formula C15H12Cl2O3 and a molecular weight of 311.2 g/mol. IUPAC name: 4-[(2-chlorophenyl)methoxy]-3-methoxybenzoyl chloride. InChIKey: BGAMIEOPOMVIBI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12Cl2O3
Molecular weight311.2 g/mol
IUPAC name4-[(2-chlorophenyl)methoxy]-3-methoxybenzoyl chloride
InChIKeyBGAMIEOPOMVIBI-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)C(=O)Cl)OCC2=CC=CC=C2Cl

Computed by PubChem (NCBI)