CAS 34294-67-2 appears in our catalog under these names: Dibenzo(b,e)(1,4)dioxine–2,3,7,8–tetraamine, Dibenzo[b,e][1,4]dioxine-2,3,7,8-tetraamine, 97%, 97%, Dibenzo[b,e][1,4]dioxine-2,3,7,8-tetraamine, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
Dibenzo-p-dioxin-2,3,7,8-tetramine (CAS 34294-67-2) is a chemical compound with the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. IUPAC name: dibenzo-p-dioxin-2,3,7,8-tetramine. InChIKey: SCNPGKBZQYWAPN-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O2 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | dibenzo-p-dioxin-2,3,7,8-tetramine |
| InChIKey | SCNPGKBZQYWAPN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC3=C(O2)C=C(C(=C3)N)N)N)N |
Computed by PubChem (NCBI)