Products 343322-60-1
CAS 343322-60-1 appears in our catalog under these names: 2-(4-Ethylphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%, 2-(4-Ethylphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(4-ethylphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 343322-60-1) is a chemical compound with the molecular formula C13H13NO2S and a molecular weight of 247.31 g/mol. IUPAC name: 2-(4-ethylphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: PJCLTRLEYYGFNR-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | 2-(4-ethylphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | PJCLTRLEYYGFNR-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=NC(=C(S2)C(=O)O)C |
Computed by PubChem (NCBI)