Products 34337-17-2

CAS 34337-17-2 is the registry number for 2-(4-Chlorobenzamido)hexanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(4-chlorobenzoyl)amino]hexanoic acid (CAS 34337-17-2) is a chemical compound with the molecular formula C13H16ClNO3 and a molecular weight of 269.72 g/mol. IUPAC name: 2-[(4-chlorobenzoyl)amino]hexanoic acid. InChIKey: CGELAGQAQFTJJP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16ClNO3
Molecular weight269.72 g/mol
IUPAC name2-[(4-chlorobenzoyl)amino]hexanoic acid
InChIKeyCGELAGQAQFTJJP-UHFFFAOYSA-N
SMILESCCCCC(C(=O)O)NC(=O)C1=CC=C(C=C1)Cl

Computed by PubChem (NCBI)