CAS 343604-05-7 appears in our catalog under these names: 3′,4′–Dimethyl–biphenyl–4–carbaldehyde, 3',4'-Dimethyl-[1,1'-biphenyl]-4-carbaldehyde, ≥97%, ≥97%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g.
4-(3,4-dimethylphenyl)benzaldehyde (CAS 343604-05-7) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: 4-(3,4-dimethylphenyl)benzaldehyde. InChIKey: FWBMHVOMCSIWCX-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 4-(3,4-dimethylphenyl)benzaldehyde |
| InChIKey | FWBMHVOMCSIWCX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=C(C=C2)C=O)C |
Computed by PubChem (NCBI)