CAS 34374-67-9 appears in our catalog under these names: 5,6-Dichloro-1H-1,2,3-benzotriazole, 95%, 5,6-Dichloro-1H-1,2,3-benzotriazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5,6-dichloro-2H-benzotriazole (CAS 34374-67-9) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 5,6-dichloro-2H-benzotriazole. InChIKey: HHEBHJLYNLALHM-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 5,6-dichloro-2H-benzotriazole |
| InChIKey | HHEBHJLYNLALHM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=NNN=C21)Cl)Cl |
Computed by PubChem (NCBI)