CAS 343960-74-7 is the registry number for Cis–4–(2–(4–hydroxyphenyl)–1,2–diphenylethenyl)phenol. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
4-[(Z)-2-(4-hydroxyphenyl)-1,2-diphenylethenyl]phenol (CAS 343960-74-7) is a chemical compound with the molecular formula C26H20O2 and a molecular weight of 364.4 g/mol. IUPAC name: 4-[(Z)-2-(4-hydroxyphenyl)-1,2-diphenylethenyl]phenol. InChIKey: ZYIGFXHZSKIVOO-QPLCGJKRSA-N.
| Molecular formula | C26H20O2 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 4-[(Z)-2-(4-hydroxyphenyl)-1,2-diphenylethenyl]phenol |
| InChIKey | ZYIGFXHZSKIVOO-QPLCGJKRSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C(\C2=CC=CC=C2)/C3=CC=C(C=C3)O)/C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)