CAS 919789-77-8 appears in our catalog under these names: 4,4'–(2,2–Diphenylethene–1,1–diyl)diphenol, 4,4'-(2,2-Diphenylethene-1,1-diyl)diphenol 95%, 4,4'-(2,2-Diphenylethene-1,1-diyl)diphenol, 95%, 95%, 4,4'-(2,2-Diphenylethene-1,1-diyl)diphenol, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 25g, 5g.
4-[1-(4-hydroxyphenyl)-2,2-diphenylethenyl]phenol (CAS 919789-77-8) is a chemical compound with the molecular formula C26H20O2 and a molecular weight of 364.4 g/mol. IUPAC name: 4-[1-(4-hydroxyphenyl)-2,2-diphenylethenyl]phenol. InChIKey: OXBSSBYVVMIMMP-UHFFFAOYSA-N.
| Molecular formula | C26H20O2 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 4-[1-(4-hydroxyphenyl)-2,2-diphenylethenyl]phenol |
| InChIKey | OXBSSBYVVMIMMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)