CAS 68578-79-0 appears in our catalog under these names: 4,4'–(1,2–Diphenyl–1,2–ethenediyl)bis(phenol), 4,4'-(1,2-Diphenylethene-1,2-diyl)diphenol, 4,4'-(1,2-Diphenylethene-1,2-diyl)diphenol (cis- and trans- mixture), >95.0%(HPLC), 4,4'-(1,2-Diphenylethene-1,2-diyl)diphenol 97%, 4,4'-(1,2-DIPHENYLETHENE-1,2-DIYL)DIPHEN. Offered by: GLPBio, Biosynth, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 25g, 5g, 50mg, 100mg, 200mg, 250mg, 500mg.
4-[(E)-2-(4-hydroxyphenyl)-1,2-diphenylethenyl]phenol (CAS 68578-79-0) is a chemical compound with the molecular formula C26H20O2 and a molecular weight of 364.4 g/mol. IUPAC name: 4-[(E)-2-(4-hydroxyphenyl)-1,2-diphenylethenyl]phenol. InChIKey: ZYIGFXHZSKIVOO-OCEACIFDSA-N.
| Molecular formula | C26H20O2 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 4-[(E)-2-(4-hydroxyphenyl)-1,2-diphenylethenyl]phenol |
| InChIKey | ZYIGFXHZSKIVOO-OCEACIFDSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C(/C2=CC=CC=C2)\C3=CC=C(C=C3)O)/C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)