CAS 344298-99-3 appears in our catalog under these names: Propranolol-d7 (Naphthalenyl-d7), rac-Propranolol-d7, >95% (HPLC), (±)-Propranolol-d7 (ring-d7), 97 atom % D, min 98% Chemical Purity, Propranolol D7 (ring D7), (±)–Propranolol–d7. Offered by: Chemat Brand, TRC, CDN, Dr. Ehrenstorfer, GLPBio. Available pack sizes: on request, 10mg, 2,5mg, 25mg, 0,05g, 0,01g, 1mg, 5mg.
1-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)oxy-3-(propan-2-ylamino)propan-2-ol (CAS 344298-99-3) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 266.39 g/mol. IUPAC name: 1-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)oxy-3-(propan-2-ylamino)propan-2-ol. InChIKey: AQHHHDLHHXJYJD-MIBSYSDMSA-N.
| Molecular formula | C16H21NO2 |
|---|---|
| Molecular weight | 266.39 g/mol |
| IUPAC name | 1-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)oxy-3-(propan-2-ylamino)propan-2-ol |
| InChIKey | AQHHHDLHHXJYJD-MIBSYSDMSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2OCC(CNC(C)C)O)[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)