CAS 98897-23-5 appears in our catalog under these names: Propranolol-d7 (N-Isopropyl-d7), rac-Propranolol-d7, >95% (HPLC), rac-Propranolol-d7, Propranolol-d7, 99.0%. Offered by: Chemat Brand, TRC, TargetMol, Biosynth, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 1mg, 2mg, 10mg, 5mg, 1 mg.
1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-naphthalen-1-yloxypropan-2-ol (CAS 98897-23-5) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 266.39 g/mol. IUPAC name: 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-naphthalen-1-yloxypropan-2-ol. InChIKey: AQHHHDLHHXJYJD-QLWPOVNFSA-N.
| Molecular formula | C16H21NO2 |
|---|---|
| Molecular weight | 266.39 g/mol |
| IUPAC name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-naphthalen-1-yloxypropan-2-ol |
| InChIKey | AQHHHDLHHXJYJD-QLWPOVNFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=CC2=CC=CC=C21)O |
Computed by PubChem (NCBI)