Products 344299-45-2
CAS 344299-45-2 appears in our catalog under these names: (3,4,5-Trimethoxyphenyl)acetic-alpha,alpha-d2 Acid, 97 atom % D, min 98% Chemical Purity, 3,4,5-Trimethoxyphenylacetic acid-d2. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
2,2-dideuterio-2-(3,4,5-trimethoxyphenyl)acetic acid (CAS 344299-45-2) is a chemical compound with the molecular formula C11H14O5 and a molecular weight of 228.24 g/mol. IUPAC name: 2,2-dideuterio-2-(3,4,5-trimethoxyphenyl)acetic acid. InChIKey: DDSJXCGGOXKGSJ-NCYHJHSESA-N.
| Molecular formula | C11H14O5 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 2,2-dideuterio-2-(3,4,5-trimethoxyphenyl)acetic acid |
| InChIKey | DDSJXCGGOXKGSJ-NCYHJHSESA-N |
| SMILES | [2H]C([2H])(C1=CC(=C(C(=C1)OC)OC)OC)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Benzeneacetic-d2 acid, 3,4,5-trimethoxy-, (3,4,5-Trimethoxyphenyl)acetic-2,2 Acid-d2, (3,4,5-Trimethoxyphenyl)acetic-alpha,alpha-d2 Acid, (3,4,5-Trimethoxyphenyl)acetic-?,?-d2 Acid, (3,4,5-Trimethoxyphenyl)acetic-2,2-d2 Acid, (3,4,5-Trimethoxyphenyl)(~2~H_2_)acetic acid, 2,2-dideuterio-2-(3,4,5-trimethoxyphenyl)acetic acid