CAS 344551-33-3 is the registry number for (R)-2-((tert-Butoxycarbonyl)amino)-2-(p-tolyl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2R)-2-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 344551-33-3) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2R)-2-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: SNDBWQDZODFRCK-LLVKDONJSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2R)-2-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | SNDBWQDZODFRCK-LLVKDONJSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)