Products 34463-68-8
CAS 34463-68-8 is the registry number for Ethyl (4z)-4-[(dimethylamino)methylidene]-2-methyl-5-oxo-4,5-dihydro-1h-pyrrole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl (4Z)-4-(dimethylaminomethylidene)-2-methyl-5-oxo-1H-pyrrole-3-carboxylate (CAS 34463-68-8) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. IUPAC name: ethyl (4Z)-4-(dimethylaminomethylidene)-2-methyl-5-oxo-1H-pyrrole-3-carboxylate. InChIKey: QXTQHUXJQPXGTP-VURMDHGXSA-N.
| Molecular formula | C11H16N2O3 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | ethyl (4Z)-4-(dimethylaminomethylidene)-2-methyl-5-oxo-1H-pyrrole-3-carboxylate |
| InChIKey | QXTQHUXJQPXGTP-VURMDHGXSA-N |
| SMILES | CCOC(=O)C\1=C(NC(=O)/C1=C\N(C)C)C |
Computed by PubChem (NCBI)