Products 34522-38-8
CAS 34522-38-8 is the registry number for Spiroamantadine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-but-2-enedioic acid;1'-methylspiro[adamantane-2,3'-pyrrolidine] (CAS 34522-38-8) is a chemical compound with the molecular formula C18H27NO4 and a molecular weight of 321.4 g/mol. IUPAC name: (Z)-but-2-enedioic acid;1'-methylspiro[adamantane-2,3'-pyrrolidine]. InChIKey: SWIQYYKGWFIKJQ-BTJKTKAUSA-N.
| Molecular formula | C18H27NO4 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;1'-methylspiro[adamantane-2,3'-pyrrolidine] |
| InChIKey | SWIQYYKGWFIKJQ-BTJKTKAUSA-N |
| SMILES | CN1CCC2(C1)C3CC4CC(C3)CC2C4.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)