CAS 34635-34-2 appears in our catalog under these names: 2–(4–Methylphenylsulfonamido)–3–phenylpropanoic acid, 2-(4-Methylphenylsulfonamido)-3-phenylpropanoic acid, 98%, 2-([(4-Methylphenyl)sulfonyl]amino)-3-phenylpropanoic acid, 95%, N-((4-Methylphenyl)sulfonyl)phenylalanine, Tos-DL-Phe-OH 95%. Offered by: GLPBio, Fluorochem, Combi-blocks, Biosynth, Ambeed. Available pack sizes: 5g, 10g, 1g, 250mg.
2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid (CAS 34635-34-2) is a chemical compound with the molecular formula C16H17NO4S and a molecular weight of 319.4 g/mol. IUPAC name: 2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid. InChIKey: CGRCVIZBNRUWLY-UHFFFAOYSA-N.
| Molecular formula | C16H17NO4S |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid |
| InChIKey | CGRCVIZBNRUWLY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)