CAS 3464-68-4 appears in our catalog under these names: 1-O-Demethyl Colchicine, 1-Demethylcolchicine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 250mg, 10mg, 25mg, 50mg, 100mg.
N-[(7S)-1-hydroxy-2,3,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide (CAS 3464-68-4) is a chemical compound with the molecular formula C21H23NO6 and a molecular weight of 385.4 g/mol. IUPAC name: N-[(7S)-1-hydroxy-2,3,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide. InChIKey: IGLDJTYPTSDFND-HNNXBMFYSA-N.
| Molecular formula | C21H23NO6 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | N-[(7S)-1-hydroxy-2,3,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
| InChIKey | IGLDJTYPTSDFND-HNNXBMFYSA-N |
| SMILES | CC(=O)N[C@H]1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)O)OC)OC |
Computed by PubChem (NCBI)