CAS 34645-25-5 appears in our catalog under these names: (1R)-1,2-Diphenylethan-1-amine, 95%, 95%, (1R)-1,2-Diphenylethan-1-amine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(1R)-1,2-diphenylethanamine (CAS 34645-25-5) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: (1R)-1,2-diphenylethanamine. InChIKey: DTGGNTMERRTPLR-CQSZACIVSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | (1R)-1,2-diphenylethanamine |
| InChIKey | DTGGNTMERRTPLR-CQSZACIVSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C2=CC=CC=C2)N |
Computed by PubChem (NCBI)