Products 3465-69-8
CAS 3465-69-8 appears in our catalog under these names: 5，7–Dimethoxyisobenzofuran–1(3H)–one, 5,7-dimethoxy-2-benzofuran-1(3H)-one/ 99.66% (existing batch purity), 5,7-dimethoxy-2-benzofuran-1(3H)-one, 98%, 98%, 5,7-Dimethoxyphthalide, 99.97%, 5,7-Dimethoxyisobenzofuran-1(3H)-one, 98%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 250mg, 1g.
5,7-dimethoxy-3H-2-benzofuran-1-one (CAS 3465-69-8) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 5,7-dimethoxy-3H-2-benzofuran-1-one. InChIKey: ODHPXVGFARBBSK-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 5,7-dimethoxy-3H-2-benzofuran-1-one |
| InChIKey | ODHPXVGFARBBSK-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=O)OC2 |
Computed by PubChem (NCBI)